2-fluoro-4-formylbenzonitrile
Catalog No: FT-0651250
CAS No: 101048-76-4
- Chemical Name: 2-fluoro-4-formylbenzonitrile
- Molecular Formula: C8H4FNO
- Molecular Weight: 149.12
- InChI Key: MYUPCEIJNBAAFL-UHFFFAOYSA-N
- InChI: InChI=1S/C8H4FNO/c9-8-3-6(5-11)1-2-7(8)4-10/h1-3,5H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 149.122 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 101048-76-4 |
| Bolling_Point: | 276.4±25.0 °C at 760 mmHg |
| Product_Name: | 4-Cyano-3-fluorobenzaldehyde |
| Melting_Point: | 80-84ºC(lit.) |
| Flash_Point: | 121.0±23.2 °C |
| MF: | C8H4FNO |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.35 |
| Flash_Point: | 121.0±23.2 °C |
| Melting_Point: | 80-84ºC(lit.) |
| FW: | 149.122 |
| PSA: | 40.86000 |
| Exact_Mass: | 149.027695 |
| MF: | C8H4FNO |
| Bolling_Point: | 276.4±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.527 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn,T,Xi |
| Risk_Statements(EU): | R20/21/22 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2926909090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)